EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1cc(C)c2c(=O)c3c(O)cc(OC)cc3oc2c1 |
| InChI | InChI=1S/C16H14O5/c1-8-4-9(19-2)6-12-14(8)16(18)15-11(17)5-10(20-3)7-13(15)21-12/h4-7,17H,1-3H3 |
| InChIKey | QDLAGTHXVHQKRE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude n-hexane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lichexanthone (CHEBI:67821) has role plant metabolite (CHEBI:76924) |
| lichexanthone (CHEBI:67821) is a aromatic ether (CHEBI:35618) |
| lichexanthone (CHEBI:67821) is a phenols (CHEBI:33853) |
| lichexanthone (CHEBI:67821) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1-hydroxy-3,6-dimethoxy-8-methyl-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1-hydroxy-3,6-dimethoxy-8-methylxanthen-9-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00037418 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:274869 | Reaxys |
| CAS:15222-53-4 | ChemIDplus |
| Citations |
|---|