EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]1([C@@H](C)CCC=C(C)C)C=C[C@](C)(O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H26O2/c1-11(2)6-5-7-12(3)13-8-9-15(4,17)14(16)10-13/h6,8-9,12-14,16-17H,5,7,10H2,1-4H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | YRFJMOGROZTYPC-XGUBFFRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude dichloromethane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Dihydroxybisabola-4,10-diene (CHEBI:67820) has role metabolite (CHEBI:25212) |
| 2,3-Dihydroxybisabola-4,10-diene (CHEBI:67820) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1S,2S,5R)-2-Methyl-5-[(2S)-6-methyl-5-hepten-2-yl]-3-cyclohexene-1,2-diol | ChEBI |
| Citations |
|---|