EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | CC(C)=CCCC(C)C1CC=C(C)C(O)C1O |
| InChI | InChI=1S/C15H26O2/c1-10(2)6-5-7-11(3)13-9-8-12(4)14(16)15(13)17/h6,8,11,13-17H,5,7,9H2,1-4H3 |
| InChIKey | SDAWXTDBEYZMMX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupania cinerea (ncbitaxon:298314) | bark (BTO:0001301) | PubMed (21438586) | Crude dichloromethane extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-Dihydroxybisabola-3,10-diene (CHEBI:67819) has role metabolite (CHEBI:25212) |
| 1,2-Dihydroxybisabola-3,10-diene (CHEBI:67819) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 3-methyl-6-(6-methylhept-5-en-2-yl)cyclohex-3-ene-1,2-diol | ChEBI |
| Citations |
|---|