EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H85N19O21S2 |
| Net Charge | 0 |
| Average Mass | 1412.531 |
| Monoisotopic Mass | 1411.56088 |
| SMILES | [H][C@]1(O[C@H]2[C@@H](O)[C@H](O)[C@H](C)O[C@@]2([H])O[C@@H](c2cncn2)[C@H](NC(=O)c2nc([C@H](CC(N)=O)NC[C@H](N)C(N)=O)nc(N)c2C)C(=O)N[C@H](CCO)[C@@H](O)[C@H](C)C(=O)N[C@H](C(=O)NCCC2=N[C@@H](c3nc(C(=O)NCCC(=N)N)cs3)CS2)C(C)(C)O)O[C@H](CO)[C@@H](O)[C@H](OC(N)=O)[C@@H]1O |
| InChI | InChI=1S/C55H85N19O21S2/c1-19-32(71-45(74-43(19)60)24(12-30(59)77)66-13-22(56)44(61)83)48(86)72-33(39(25-14-63-18-67-25)93-53-41(37(81)35(79)21(3)91-53)94-52-38(82)40(95-54(62)89)36(80)28(15-76)92-52)49(87)69-23(8-11-75)34(78)20(2)46(84)73-42(55(4,5)90)50(88)65-10-7-31-68-27(17-96-31)51-70-26(16-97-51)47(85)64-9-6-29(57)58/h14,16,18,20-24,27-28,33-42,52-53,66,75-76,78-82,90H,6-13,15,17,56H2,1-5H3,(H3,57,58)(H2,59,77)(H2,61,83)(H2,62,89)(H,63,67)(H,64,85)(H,65,88)(H,69,87)(H,72,86)(H,73,84)(H2,60,71,74)/t20-,21-,22-,23+,24-,27+,28+,33-,34-,35+,36+,37-,38-,39-,40-,41-,42+,52+,53-/m0/s1 |
| InChIKey | UJKRUPHWCPAJIL-CPLCKGKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces flavoviridis (ncbitaxon:66889) | - | PubMed (21210656) | Strain: ATCC21892 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zorbamycin (CHEBI:67811) has role antimicrobial agent (CHEBI:33281) |
| zorbamycin (CHEBI:67811) has role bacterial metabolite (CHEBI:76969) |
| zorbamycin (CHEBI:67811) is a glycopeptide (CHEBI:24396) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11042140 | Reaxys |
| CAS:11056-20-5 | ChemIDplus |
| Citations |
|---|