EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | [H][C@@]12[C@H](O)C[C@@H](CO)[C@@]1([H])C[C@@]1(C)CC[C@]([H])([C@H](C)CO)/C1=C/C[C@]2(C)O |
| InChI | InChI=1S/C20H34O4/c1-12(10-21)14-4-6-19(2)9-15-13(11-22)8-17(23)18(15)20(3,24)7-5-16(14)19/h5,12-15,17-18,21-24H,4,6-11H2,1-3H3/b16-5-/t12-,13+,14-,15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | ZRHLUTXOIYNCOW-QMDVJOKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (21314175) | Ethylacetate extract of culture broth Strain: MTE4a |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-hydroxycyclooctatin, (rel)- (CHEBI:67808) has role metabolite (CHEBI:25212) |
| 17-hydroxycyclooctatin, (rel)- (CHEBI:67808) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-(1R,3R,3aS,4S,6Z,7R,9aR,10aR)-1-(Hydroxymethyl)-7-[(2S)-1-hydroxy-2-propanyl]-4,9a-dimethyl-1,2,3,3a,4,5,7,8,9,9a,10,10a-dodecahydrodicyclopenta[a,d][8]annulene-3,4-diol | ChEBI |
| Citations |
|---|