EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | [H][C@@]12C[C@H](C(C)(C)O)CC[C@@]1(C)CCC[C@@]2(C)O |
| InChI | InChI=1S/C15H28O2/c1-13(2,16)11-6-9-14(3)7-5-8-15(4,17)12(14)10-11/h11-12,16-17H,5-10H2,1-4H3/t11-,12-,14-,15-/m1/s1 |
| InChIKey | LKKDASYGWYYFIK-QHSBEEBCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Blumea balsamifera (ncbitaxon:313920) | leaf (BTO:0000713) | PubMed (21319848) | Methanolic extract of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptomeridiol (CHEBI:67796) has role metabolite (CHEBI:25212) |
| cryptomeridiol (CHEBI:67796) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| Synonyms | Source |
|---|---|
| proximadiol | ChEBI |
| (1R,4aR,7R,8aR)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol | ChEBI |
| Proximadiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17676 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:4666-84-6 | KEGG COMPOUND |
| Citations |
|---|