EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | CC1=C2C(=O)[C@H](C(C)C)C[C@H](O)[C@@]2(C)C(=O)CC1 |
| InChI | InChI=1S/C15H22O3/c1-8(2)10-7-12(17)15(4)11(16)6-5-9(3)13(15)14(10)18/h8,10,12,17H,5-7H2,1-4H3/t10-,12-,15+/m0/s1 |
| InChIKey | NMZVEZTUCAUFCR-ITDIGPHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Blumea balsamifera (ncbitaxon:313920) | leaf (BTO:0000713) | PubMed (21319848) | Methanolic extract of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Samboginone, (rel)- (CHEBI:67795) has role metabolite (CHEBI:25212) |
| Samboginone, (rel)- (CHEBI:67795) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| Citations |
|---|