EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O7 |
| Net Charge | 0 |
| Average Mass | 384.469 |
| Monoisotopic Mass | 384.21480 |
| SMILES | CC1=C2C(=O)[C@H](C(C)C)C[C@H](OC(=O)C(C)(O)C(C)O)[C@@](C)(O)[C@]2(O)CC1 |
| InChI | InChI=1S/C20H32O7/c1-10(2)13-9-14(27-17(23)18(5,24)12(4)21)19(6,25)20(26)8-7-11(3)15(20)16(13)22/h10,12-14,21,24-26H,7-9H2,1-6H3/t12?,13-,14-,18?,19+,20-/m0/s1 |
| InChIKey | DOZVKVJPJOEXOY-QSUDUBMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Blumea balsamifera (ncbitaxon:313920) | leaf (BTO:0000713) | PubMed (21319848) | Methanolic extract of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Blumeaene K, (rel)- (CHEBI:67792) has role metabolite (CHEBI:25212) |
| Blumeaene K, (rel)- (CHEBI:67792) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|