EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H36O9 |
| Net Charge | 0 |
| Average Mass | 588.653 |
| Monoisotopic Mass | 588.23593 |
| SMILES | [H][C@@]12C[C@H](C)C(=O)[C@@]1(O)[C@H](O)[C@@]1(C)O[C@@]1([H])[C@@]1([H])[C@@]3([H])OC4(c5ccccc5)O[C@@]21[C@H](C)[C@H](OC(=O)c1ccccc1)[C@]3(C(=C)C)O4 |
| InChI | InChI=1S/C34H36O9/c1-17(2)32-25(39-28(36)20-12-8-6-9-13-20)19(4)33-22-16-18(3)24(35)31(22,38)29(37)30(5)26(40-30)23(33)27(32)41-34(42-32,43-33)21-14-10-7-11-15-21/h6-15,18-19,22-23,25-27,29,37-38H,1,16H2,2-5H3/t18-,19+,22+,23-,25-,26-,27+,29+,30-,31+,32-,33-,34?/m0/s1 |
| InChIKey | VUPIVOZJYBEXBH-CNRLWDEJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon thyrsoideum (ncbitaxon:289660) | root (BTO:0001188) | PubMed (21192108) | Methanolic extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trigoxyphin B (CHEBI:67786) has role metabolite (CHEBI:25212) |
| trigoxyphin B (CHEBI:67786) is a diterpenoid (CHEBI:23849) |
| Manual Xrefs | Databases |
|---|---|
| 25048591 | ChemSpider |
| Citations |
|---|