EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H40O10 |
| Net Charge | 0 |
| Average Mass | 608.684 |
| Monoisotopic Mass | 608.26215 |
| SMILES | [H][C@@]12C[C@H](C)[C@H](O)[C@@]1(O)[C@H](O)[C@](C)(O)[C@@H](O)[C@@]1([H])[C@@]3([H])OC4(c5ccccc5)O[C@@]21[C@H](C)[C@H](OC(=O)c1ccccc1)[C@]3(C(=C)C)O4 |
| InChI | InChI=1S/C34H40O10/c1-17(2)32-26(41-28(37)20-12-8-6-9-13-20)19(4)33-22-16-18(3)24(35)31(22,40)29(38)30(5,39)25(36)23(33)27(32)42-34(43-32,44-33)21-14-10-7-11-15-21/h6-15,18-19,22-27,29,35-36,38-40H,1,16H2,2-5H3/t18-,19+,22+,23-,24-,25-,26-,27+,29+,30+,31+,32-,33-,34?/m0/s1 |
| InChIKey | QAXWNKPPCNIRQP-XAKMMCORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon thyrsoideum (ncbitaxon:289660) | root (BTO:0001188) | PubMed (21192108) | Methanolic extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trigonosin C (CHEBI:67781) has role metabolite (CHEBI:25212) |
| Trigonosin C (CHEBI:67781) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|