EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21BrCl2O |
| Net Charge | 0 |
| Average Mass | 368.142 |
| Monoisotopic Mass | 366.01528 |
| SMILES | C#C/C=C\C[C@@H](O)[C@H](Cl)C/C=C\C[C@@H](Cl)[C@H](Br)CC |
| InChI | InChI=1S/C15H21BrCl2O/c1-3-5-6-11-15(19)14(18)10-8-7-9-13(17)12(16)4-2/h1,5-8,12-15,19H,4,9-11H2,2H3/b6-5-,8-7-/t12-,13-,14-,15-/m1/s1 |
| InChIKey | GGOGTQISOAHDFM-IKEITHOESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurencia marilzae (ncbitaxon:99905) | - | PubMed (21338119) | CH2Cl2/MeOH(1:1,v/v) extract of fresh alga and Z-isomer of Adrienyne |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Z-Adrienyne, (rel)- (CHEBI:67777) has role metabolite (CHEBI:25212) |
| Z-Adrienyne, (rel)- (CHEBI:67777) is a alcohol (CHEBI:30879) |
| Z-Adrienyne, (rel)- (CHEBI:67777) is a organochlorine compound (CHEBI:36683) |
| Synonym | Source |
|---|---|
| threo-(3Z,9Z)-13-bromo-7,12-dichloropentadeca-3,9-dien-1-yn-6-ol | ChEBI |
| Citations |
|---|