EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20BrClO2 |
| Net Charge | 0 |
| Average Mass | 347.680 |
| Monoisotopic Mass | 346.03352 |
| SMILES | C/C=C/[C@H]1C/C=C\C[C@@H](Cl)[C@@H](C[C@@H](O)C=C=CBr)O1 |
| InChI | InChI=1S/C15H20BrClO2/c1-2-6-13-8-3-4-9-14(17)15(19-13)11-12(18)7-5-10-16/h2-4,6-7,10,12-15,18H,8-9,11H2,1H3/b4-3-,6-2+/t5?,12-,13-,14+,15+/m0/s1 |
| InChIKey | UAKMIDIJYGIRKO-LFOVUXSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurencia marilzae (ncbitaxon:99905) | - | PubMed (21338119) | CH2Cl2/MeOH(1:1,v/v) extract of fresh alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Marilzallene, (rel)- (CHEBI:67774) has role metabolite (CHEBI:25212) |
| Marilzallene, (rel)- (CHEBI:67774) is a allenes (CHEBI:37602) |
| Marilzallene, (rel)- (CHEBI:67774) is a oxacycle (CHEBI:38104) |
| Synonym | Source |
|---|---|
| rel-(2R,3S)-5-Bromo-1-{(2R,3R,5Z,8R)-3-chloro-8-[(1E)-1-propen-1-yl]-3,4,7,8-tetrahydro-2H-oxocin-2-yl}-3,4-pentadien-2-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27026674 | ChemSpider |
| Citations |
|---|