EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19Br2ClO3 |
| Net Charge | 0 |
| Average Mass | 442.575 |
| Monoisotopic Mass | 439.93895 |
| SMILES | [H][C@@]12C[C@H](C=C=CBr)O[C@@H](C)[C@@]3([H])O[C@]3([H])C[C@H](Br)[C@]([H])(C[C@H]1Cl)O2 |
| InChI | InChI=1S/C15H19Br2ClO3/c1-8-15-14(21-15)6-10(17)12-7-11(18)13(20-12)5-9(19-8)3-2-4-16/h3-4,8-15H,5-7H2,1H3/t2?,8-,9-,10-,11+,12-,13+,14+,15+/m0/s1 |
| InChIKey | KKVLDYZJUNUWNP-WBMUAMOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurencia marilzae (ncbitaxon:99905) | - | PubMed (21338119) | CH2Cl2/MeOH(1:1,v/v) extract of fresh alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-Epoxyobtusallene IV (CHEBI:67772) has role metabolite (CHEBI:25212) |
| 12-Epoxyobtusallene IV (CHEBI:67772) is a allenes (CHEBI:37602) |
| 12-Epoxyobtusallene IV (CHEBI:67772) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| (1S,2S,4R,6R,7S,9R,11R,12R)-2-Bromo-9-[(1S)-3-bromopropadienyl]-12-chloro-7-methyl-5,8,14-trioxatricyclo[9.2.1.0[4,6]]tetradecane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27026661 | ChemSpider |
| Citations |
|---|