EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H56N2 |
| Net Charge | 0 |
| Average Mass | 456.803 |
| Monoisotopic Mass | 456.44435 |
| SMILES | [H][C@@]12CC/C=C\CCCCCCN3CC[C@]4([H])[C@@]([H])(CN(CC[C@@H](C)CCCCCCC[C@]4([H])C3)C1)C2 |
| InChI | InChI=1S/C31H56N2/c1-27-15-11-7-6-9-13-17-29-25-32-20-14-10-5-3-2-4-8-12-16-28-23-30(31(29)19-22-32)26-33(24-28)21-18-27/h4,8,27-31H,2-3,5-7,9-26H2,1H3/b8-4-/t27-,28-,29+,30+,31-/m0/s1 |
| InChIKey | ASUYCOBPLIZBDP-OBDYYNBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neopetrosia proxima (WORMS:378581) | - | PubMed (21341726) | The sample was extracted with methanol and then with CH2Cl2/MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xestoproxamine C, (rel)- (CHEBI:67771) has role metabolite (CHEBI:25212) |
| Xestoproxamine C, (rel)- (CHEBI:67771) is a piperidines (CHEBI:26151) |
| Synonym | Source |
|---|---|
| rel-(4S,12S,13S,23Z,27S,29S)-4-Methyl-1,16-diazatetracyclo[25.3.1.1(12,16).0(13,29)]dotriacont-23-ene | ChEBI |
| Citations |
|---|