EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H54N2 |
| Net Charge | 0 |
| Average Mass | 442.776 |
| Monoisotopic Mass | 442.42870 |
| SMILES | [H][C@@]12CC/C=C\CCCCCCN3CC[C@@]4([H])[C@@]([H])(CCCCCCCCCCN(C1)C[C@@]4([H])C2)C3 |
| InChI | InChI=1S/C30H54N2/c1-3-7-11-15-20-31-22-19-30-28(25-31)18-14-10-6-2-4-8-12-16-21-32-24-27(17-13-9-5-1)23-29(30)26-32/h5,9,27-30H,1-4,6-8,10-26H2/b9-5-/t27-,28-,29+,30-/m0/s1 |
| InChIKey | BYZUJRCVLKUHIW-XIJZRPANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neopetrosia proxima (WORMS:378581) | - | PubMed (21341726) | The sample was extracted with methanol and then with CH2Cl2/MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xestoproxamine B, (rel)- (CHEBI:67770) has role metabolite (CHEBI:25212) |
| Xestoproxamine B, (rel)- (CHEBI:67770) is a piperidines (CHEBI:26151) |
| Synonym | Source |
|---|---|
| rel-(12R,13S,23Z,27S,29S)-1,16-Diazatetracyclo[25.3.1.1(12,16).0(13,29)]dotriacont-23-ene | ChEBI |
| Citations |
|---|