EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O5 |
| Net Charge | 0 |
| Average Mass | 236.223 |
| Monoisotopic Mass | 236.06847 |
| SMILES | C=C1OC(=O)c2c(O)cc(O)c(C)c2[C@@]1(C)O |
| InChI | InChI=1S/C12H12O5/c1-5-7(13)4-8(14)9-10(5)12(3,16)6(2)17-11(9)15/h4,13-14,16H,2H2,1,3H3/t12-/m0/s1 |
| InChIKey | RFLUVNUXLRYNNJ-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptospeciesaeria (ncbitaxon:5021) | - | PubMed (21265556) | Ethylacetate extract of culture broth Strain: KTC 727 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3,4-Dihydro-4,6,8-trihydroxy-4,5-dimethyl-3-methyleneisochromen-1-one (CHEBI:67765) has role metabolite (CHEBI:25212) |
| (R)-3,4-Dihydro-4,6,8-trihydroxy-4,5-dimethyl-3-methyleneisochromen-1-one (CHEBI:67765) is a hydroxybenzoic acid (CHEBI:24676) |
| Citations |
|---|