EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O8 |
| Net Charge | 0 |
| Average Mass | 460.523 |
| Monoisotopic Mass | 460.20972 |
| SMILES | [H][C@]12COC(C)(C)OC[C@]1([H])[C@@H](c1cc(OC)c(O)c(OC)c1)c1c(cc(OC)c(O)c1OC)C2 |
| InChI | InChI=1S/C25H32O8/c1-25(2)32-11-15-7-13-8-19(30-5)23(27)24(31-6)21(13)20(16(15)12-33-25)14-9-17(28-3)22(26)18(10-14)29-4/h8-10,15-16,20,26-27H,7,11-12H2,1-6H3/t15-,16-,20+/m0/s1 |
| InChIKey | DJEMZLJVTQVYRD-TWOQFEAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of air-dried, powdered stems and compound is isolated as (+)-Isomer |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brugunin A (CHEBI:67763) has role plant metabolite (CHEBI:76924) |
| brugunin A (CHEBI:67763) is a dimethoxybenzene (CHEBI:51681) |
| brugunin A (CHEBI:67763) is a lignan (CHEBI:25036) |
| brugunin A (CHEBI:67763) is a organic heterotricyclic compound (CHEBI:26979) |
| brugunin A (CHEBI:67763) is a oxacycle (CHEBI:38104) |
| brugunin A (CHEBI:67763) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (5aR,6S,11aR)-6-(4-hydroxy-3,5-dimethoxyphenyl)-7,9-dimethoxy-3,3-dimethyl-1,5,5a,6,11,11a-hexahydronaphtho[2,3-e][1,3]dioxepin-8-ol |
| Citations |
|---|