EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O8 |
| Net Charge | 0 |
| Average Mass | 512.599 |
| Monoisotopic Mass | 512.24102 |
| SMILES | C=CCC1=C[C@]2(O)C[C@H](C(C)(C)O)OC2=C(CC2=C3O[C@@H](C(C)(C)O)C[C@@]3(O)C=C(CC=C)C2=O)C1=O |
| InChI | InChI=1S/C29H36O8/c1-7-9-16-12-28(34)14-20(26(3,4)32)36-24(28)18(22(16)30)11-19-23(31)17(10-8-2)13-29(35)15-21(27(5,6)33)37-25(19)29/h7-8,12-13,20-21,32-35H,1-2,9-11,14-15H2,3-6H3/t20-,21-,28+,29+/m1/s1 |
| InChIKey | AVMQANMZZMKFSS-SKZNYKRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Illicium oligandrum (ncbitaxon:145286) | stem (BTO:0001300) | PubMed (21524101) | Previous component: stem bark; 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Illicidione B (CHEBI:67761) has role metabolite (CHEBI:25212) |
| Illicidione B (CHEBI:67761) is a disaccharide (CHEBI:36233) |
| Citations |
|---|