EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O2 |
| Net Charge | 0 |
| Average Mass | 468.766 |
| Monoisotopic Mass | 468.39673 |
| SMILES | C#C/C=C\[C@@H](O)CCCCCCCCCCC/C=C\CCCCCCCCC/C=C/[C@@H](O)C#C |
| InChI | InChI=1S/C32H52O2/c1-3-5-28-32(34)30-27-25-23-21-19-17-15-13-11-9-7-6-8-10-12-14-16-18-20-22-24-26-29-31(33)4-2/h1-2,5-7,26,28-29,31-34H,8-25,27,30H2/b7-6-,28-5-,29-26+/t31-,32+/m0/s1 |
| InChIKey | VIAGOLXCGUWNRZ-INHMWYDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrosia (ncbitaxon:68563) | - | PubMed (21534590) | Frozen sponge was homogenized and extracted with EtOH and MeOH/CHCl3 (1:1) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-duryne F (CHEBI:67759) has role animal metabolite (CHEBI:75767) |
| (−)-duryne F (CHEBI:67759) has role antineoplastic agent (CHEBI:35610) |
| (−)-duryne F (CHEBI:67759) has role marine metabolite (CHEBI:76507) |
| (−)-duryne F (CHEBI:67759) is a diol (CHEBI:23824) |
| (−)-duryne F (CHEBI:67759) is a enyne (CHEBI:59831) |
| (−)-duryne F (CHEBI:67759) is a secondary alcohol (CHEBI:35681) |
| (−)-duryne F (CHEBI:67759) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (3R,4E,15Z,28S,29Z)-dotriaconta-4,15,29-triene-1,31-diyne-3,28-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21556539 | Reaxys |
| Citations |
|---|