EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67757 - (−)-duryne D
| Formula | C34H54O2 |
| Net Charge | 0 |
| Average Mass | 494.804 |
| Monoisotopic Mass | 494.41238 |
| SMILES | C#C[C@H](O)/C=C/CCCCCCC/C=C\CCCC/C=C\CCCCCCCCC/C=C/[C@@H](O)C#C |
| InChI | InChI=1S/C34H54O2/c1-3-33(35)31-29-27-25-23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34(36)4-2/h1-2,7,9,12,14,29-36H,5-6,8,10-11,13,15-28H2/b9-7-,14-12-,31-29+,32-30+/t33-,34-/m0/s1 |
| InChIKey | QTTDGOHJJYZQSI-USFWFSLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrosia (ncbitaxon:68563) | - | PubMed (21534590) | Frozen sponge was homogenized and extracted with EtOH and MeOH/CHCl3 (1:1) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-duryne D (CHEBI:67757) has role animal metabolite (CHEBI:75767) |
| (−)-duryne D (CHEBI:67757) has role antineoplastic agent (CHEBI:35610) |
| (−)-duryne D (CHEBI:67757) has role marine metabolite (CHEBI:76507) |
| (−)-duryne D (CHEBI:67757) is a diol (CHEBI:23824) |
| (−)-duryne D (CHEBI:67757) is a enyne (CHEBI:59831) |
| (−)-duryne D (CHEBI:67757) is a secondary alcohol (CHEBI:35681) |
| (−)-duryne D (CHEBI:67757) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (3R,4E,13Z,19Z,30E,32R)-tetratriaconta-4,13,19,30-tetraene-1,33-diyne-3,32-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21556541 | Reaxys |
| Citations |
|---|