EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67756 - (−)-duryne C
| Formula | C32H50O2 |
| Net Charge | 0 |
| Average Mass | 466.750 |
| Monoisotopic Mass | 466.38108 |
| SMILES | C#C[C@H](O)/C=C/CCCCC/C=C\CCCC/C=C\CCCCCCCCC/C=C/[C@@H](O)C#C |
| InChI | InChI=1S/C32H50O2/c1-3-31(33)29-27-25-23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26-28-30-32(34)4-2/h1-2,5,7,14,16,27-34H,6,8-13,15,17-26H2/b7-5-,16-14-,29-27+,30-28+/t31-,32-/m0/s1 |
| InChIKey | ILEBLZYXEWLOSI-ARHWHDHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrosia (ncbitaxon:68563) | - | PubMed (21534590) | Frozen sponge was homogenized and extracted with EtOH and MeOH/CHCl3 (1:1) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-duryne C (CHEBI:67756) has role animal metabolite (CHEBI:75767) |
| (−)-duryne C (CHEBI:67756) has role antineoplastic agent (CHEBI:35610) |
| (−)-duryne C (CHEBI:67756) has role marine metabolite (CHEBI:76507) |
| (−)-duryne C (CHEBI:67756) is a diol (CHEBI:23824) |
| (−)-duryne C (CHEBI:67756) is a enyne (CHEBI:59831) |
| (−)-duryne C (CHEBI:67756) is a secondary alcohol (CHEBI:35681) |
| (−)-duryne C (CHEBI:67756) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (3R,4E,11Z,17Z,28E,30R)-dotriaconta-4,11,17,28-tetraene-1,31-diyne-3,30-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21556538 | Reaxys |
| Citations |
|---|