EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H46O13 |
| Net Charge | 0 |
| Average Mass | 734.795 |
| Monoisotopic Mass | 734.29384 |
| SMILES | [H][C@@]12C[C@H](C)[C@H](OC(C)=O)[C@@]1(O)[C@H](OC(C)=O)[C@](C)(OC(=O)c1ccccc1)[C@@H](OC(C)=O)[C@@]1([H])[C@@]3([H])OC4(c5ccccc5)O[C@@]21[C@H](C)[C@H](O)[C@]3(C(=C)C)O4 |
| InChI | InChI=1S/C40H46O13/c1-20(2)38-30(44)22(4)39-28-19-21(3)31(47-23(5)41)37(28,46)35(49-25(7)43)36(8,51-34(45)26-15-11-9-12-16-26)32(48-24(6)42)29(39)33(38)50-40(52-38,53-39)27-17-13-10-14-18-27/h9-18,21-22,28-33,35,44,46H,1,19H2,2-8H3/t21-,22+,28+,29-,30-,31-,32-,33+,35+,36+,37+,38-,39-,40?/m0/s1 |
| InChIKey | UAEKMRUKSIVWTE-XNFYJXMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon howii (IPNI:358018-1) | twig (BTO:0001411) | PubMed (21520897) | 95% ethanolic extract of air-dried, powdered twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trigoxyphin F (CHEBI:67753) has role metabolite (CHEBI:25212) |
| Trigoxyphin F (CHEBI:67753) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|