EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H50O15 |
| Net Charge | 0 |
| Average Mass | 794.847 |
| Monoisotopic Mass | 794.31497 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@@](C)(OC(=O)c3ccccc3)[C@@H](OC(C)=O)[C@]3(O)[C@@H](OC(C)=O)[C@@H](C)C[C@@]3([H])[C@@]1(O)[C@H](C)[C@H](O)[C@@](OC(=O)c1ccccc1)(C(=C)C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C42H50O15/c1-21(2)42(57-37(49)29-18-14-11-15-19-29)32(47)23(4)40(50)30-20-22(3)33(52-24(5)43)41(30,51)38(55-27(8)46)39(9,56-36(48)28-16-12-10-13-17-28)34(53-25(6)44)31(40)35(42)54-26(7)45/h10-19,22-23,30-35,38,47,50-51H,1,20H2,2-9H3/t22-,23+,30-,31-,32-,33-,34-,35+,38+,39+,40-,41+,42-/m0/s1 |
| InChIKey | BHWJAJREPXENPW-GUDQYKIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon howii (IPNI:358018-1) | twig (BTO:0001411) | PubMed (21520897) | 95% ethanolic extract of air-dried, powdered twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trigohownin G, (rel)- (CHEBI:67748) has role metabolite (CHEBI:25212) |
| Trigohownin G, (rel)- (CHEBI:67748) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|