EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H48O14 |
| Net Charge | 0 |
| Average Mass | 752.810 |
| Monoisotopic Mass | 752.30441 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@@](C)(OC(=O)c3ccccc3)[C@@H](OC(C)=O)[C@]3(O)[C@@H](OC(C)=O)[C@@H](C)C[C@@]3([H])[C@@]1(O)[C@H](C)[C@H](O)[C@@](OC(=O)c1ccccc1)(C(=C)C)[C@@H]2O |
| InChI | InChI=1S/C40H48O14/c1-20(2)40(54-35(47)27-17-13-10-14-18-27)30(44)22(4)38(48)28-19-21(3)32(50-23(5)41)39(28,49)36(52-25(7)43)37(8,33(51-24(6)42)29(38)31(40)45)53-34(46)26-15-11-9-12-16-26/h9-18,21-22,28-33,36,44-45,48-49H,1,19H2,2-8H3/t21-,22+,28-,29+,30-,31+,32-,33-,36+,37+,38-,39+,40-/m0/s1 |
| InChIKey | JJQHYPWLPPEWIU-NUZYPNBBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon howii (IPNI:358018-1) | twig (BTO:0001411) | PubMed (21520897) | 95% ethanolic extract of air-dried, powdered twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trigohownin F, (rel)- (CHEBI:67747) has role metabolite (CHEBI:25212) |
| Trigohownin F, (rel)- (CHEBI:67747) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|