EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H44O12 |
| Net Charge | 0 |
| Average Mass | 692.758 |
| Monoisotopic Mass | 692.28328 |
| SMILES | [H][C@@]12C[C@H](C)[C@H](OC(C)=O)[C@@]1(O)[C@H](OC(C)=O)[C@](C)(OC(=O)c1ccccc1)[C@@H](O)[C@@]1([H])[C@@]3([H])OC4(c5ccccc5)O[C@@H]([C@@H](C)[C@]21O4)[C@@]3(O)C(=C)C |
| InChI | InChI=1S/C38H44O12/c1-19(2)35(43)30-21(4)37-26-18-20(3)29(45-22(5)39)36(26,44)33(46-23(6)40)34(7,49-32(42)24-14-10-8-11-15-24)28(41)27(37)31(35)48-38(47-30,50-37)25-16-12-9-13-17-25/h8-17,20-21,26-31,33,41,43-44H,1,18H2,2-7H3/t20-,21+,26+,27-,28-,29-,30-,31+,33+,34+,35-,36+,37-,38?/m0/s1 |
| InChIKey | DBZRNVHEUFWTLZ-SPQNPJFSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon howii (IPNI:358018-1) | twig (BTO:0001411) | PubMed (21520897) | 95% ethanolic extract of air-dried, powdered twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trigohownin C, (rel)- (CHEBI:67744) has role metabolite (CHEBI:25212) |
| Trigohownin C, (rel)- (CHEBI:67744) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|