EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O4 |
| Net Charge | 0 |
| Average Mass | 402.575 |
| Monoisotopic Mass | 402.27701 |
| SMILES | CC1=C(CC/C(C)=C/CC/C(=C\C[C@H]2OC(=O)C=C2CO)CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H38O4/c1-18(10-12-22-19(2)8-6-14-25(22,3)4)7-5-9-20(16-26)11-13-23-21(17-27)15-24(28)29-23/h7,11,15,23,26-27H,5-6,8-10,12-14,16-17H2,1-4H3/b18-7+,20-11+/t23-/m1/s1 |
| InChIKey | VOZHIXNCTBMKNV-KXUMGZKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hippospongia lachne (ncbitaxon:479639) | - | PubMed (21548579) | 95% aqueous ethanolic extract of dried sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6E)-neomanoalide (CHEBI:67740) has role metabolite (CHEBI:25212) |
| (6E)-neomanoalide (CHEBI:67740) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| (2R)-3-(hydroxymethyl)-2-[(2E,6E)-3-(hydroxymethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]-2H-furan-5-one | ChEBI |
| Citations |
|---|