EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40O5 |
| Net Charge | 0 |
| Average Mass | 420.590 |
| Monoisotopic Mass | 420.28757 |
| SMILES | C/C(=C\CC/C(=C/C[C@H]1OC(=O)C=C1CO)CO)CC/C=C(\C)CCCC(C)CO |
| InChI | InChI=1S/C25H40O5/c1-19(9-5-11-21(3)16-26)7-4-8-20(2)10-6-12-22(17-27)13-14-24-23(18-28)15-25(29)30-24/h7,10,13,15,21,24,26-28H,4-6,8-9,11-12,14,16-18H2,1-3H3/b19-7+,20-10+,22-13-/t21?,24-/m1/s1 |
| InChIKey | CCONHYLQHTWPKT-KSCXBWFXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hippospongia lachne (ncbitaxon:479639) | - | PubMed (21548579) | 95% aqueous ethanolic extract of dried sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hippolide G (CHEBI:67738) has role metabolite (CHEBI:25212) |
| Hippolide G (CHEBI:67738) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| (2R)-2-[(2Z,6E,10E)-16-hydroxy-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10-trienyl]-3-(hydroxymethyl)-2H-furan-5-one | ChEBI |
| Citations |
|---|