EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO4 |
| Net Charge | 0 |
| Average Mass | 415.574 |
| Monoisotopic Mass | 415.27226 |
| SMILES | [H][C@]1([C@]2([H])CC(=O)NC2=O)CC=C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@@H](O)O1 |
| InChI | InChI=1S/C25H37NO4/c1-17(2)8-5-9-18(3)10-6-11-19(4)12-7-13-20-14-15-22(30-25(20)29)21-16-23(27)26-24(21)28/h8,10,12,14,21-22,25,29H,5-7,9,11,13,15-16H2,1-4H3,(H,26,27,28)/b18-10+,19-12+/t21-,22+,25-/m0/s1 |
| InChIKey | DHMXAXCAWHUFET-HVFQXGRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hippospongia lachne (ncbitaxon:479639) | - | PubMed (21548579) | 95% aqueous ethanolic extract of dried sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hippolide A (CHEBI:67732) has role metabolite (CHEBI:25212) |
| Hippolide A (CHEBI:67732) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| (3S)-3-[(2R,6S)-6-hydroxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]pyrrolidine-2,5-dione | ChEBI |
| Citations |
|---|