EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O4 |
| Net Charge | 0 |
| Average Mass | 428.613 |
| Monoisotopic Mass | 428.29266 |
| SMILES | [H]C(=O)C1=CC[C@]2([H])[C@@](C)([C@H]1C([H])=O)[C@@H](OC(C)=O)C[C@@]1([H])[C@@]2(C)CC[C@@]2([H])C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C27H40O4/c1-17(30)31-23-14-22-25(4)12-7-11-24(2,3)20(25)10-13-26(22,5)21-9-8-18(15-28)19(16-29)27(21,23)6/h8,15-16,19-23H,7,9-14H2,1-6H3/t19-,20-,21-,22+,23-,25-,26-,27+/m0/s1 |
| InChIKey | ADWFEADZGIHPDE-QGERINELSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge. |
| Cacospongia mollior (ncbitaxon:1162743) | - | DOI (10.1007/BF01938315) | |
| Glossodoris rufomarginata (ncbitaxon:508147) | - | PubMed (15620263) | |
| Hypomontagnella monticulosa (ncbitaxon:2487000) | - | PubMed (33665446) | Strain: Zg15SU |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scalaradial (CHEBI:67731) has role animal metabolite (CHEBI:75767) |
| scalaradial (CHEBI:67731) has role anti-inflammatory agent (CHEBI:67079) |
| scalaradial (CHEBI:67731) has role apoptosis inducer (CHEBI:68495) |
| scalaradial (CHEBI:67731) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| scalaradial (CHEBI:67731) has role marine metabolite (CHEBI:76507) |
| scalaradial (CHEBI:67731) has role TRP channel blocker (CHEBI:139361) |
| scalaradial (CHEBI:67731) is a acetate ester (CHEBI:47622) |
| scalaradial (CHEBI:67731) is a carbotetracyclic compound (CHEBI:177332) |
| scalaradial (CHEBI:67731) is a dialdehyde (CHEBI:38124) |
| scalaradial (CHEBI:67731) is a enal (CHEBI:51688) |
| scalaradial (CHEBI:67731) is a scalarane sesterterpenoid (CHEBI:59370) |
| IUPAC Name |
|---|
| (4aS,4bR,6S,6aS,7R,10aS,10bR,12aS)-7,8-diformyl-1,1,4a,6a,10b-pentamethyl-1,2,3,4,4a,4b,5,6,6a,7,10,10a,10b,11,12,12a-hexadecahydrochrysen-6-yl acetate |
| Synonym | Source |
|---|---|
| (+)-scalaradial | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:53527-28-9 | ChemIDplus |
| Citations |
|---|