EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O4 |
| Net Charge | 0 |
| Average Mass | 428.613 |
| Monoisotopic Mass | 428.29266 |
| SMILES | [H]C(=O)C1=CC[C@]2([H])[C@@](C)([C@H]1C([H])=O)[C@@H](OC(C)=O)C[C@@]1([H])[C@@]2(C)CC[C@@]2([H])C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C27H40O4/c1-17(30)31-23-14-22-25(4)12-7-11-24(2,3)20(25)10-13-26(22,5)21-9-8-18(15-28)19(16-29)27(21,23)6/h8,15-16,19-23H,7,9-14H2,1-6H3/t19-,20-,21-,22+,23-,25-,26-,27+/m0/s1 |
| InChIKey | ADWFEADZGIHPDE-QGERINELSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mollior (ncbitaxon:1162743) | - | DOI (10.1007/BF01938315) | |
| Glossodoris rufomarginata (ncbitaxon:508147) | - | PubMed (15620263) | |
| Hypomontagnella monticulosa (ncbitaxon:2487000) | - | PubMed (33665446) | Strain: Zg15SU |
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge. |
| Roles Classification |
|---|
| Biological Roles: | TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scalaradial (CHEBI:67731) has role animal metabolite (CHEBI:75767) |
| scalaradial (CHEBI:67731) has role anti-inflammatory agent (CHEBI:67079) |
| scalaradial (CHEBI:67731) has role apoptosis inducer (CHEBI:68495) |
| scalaradial (CHEBI:67731) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| scalaradial (CHEBI:67731) has role marine metabolite (CHEBI:76507) |
| scalaradial (CHEBI:67731) has role TRP channel blocker (CHEBI:139361) |
| scalaradial (CHEBI:67731) is a acetate ester (CHEBI:47622) |
| scalaradial (CHEBI:67731) is a carbotetracyclic compound (CHEBI:177332) |
| scalaradial (CHEBI:67731) is a dialdehyde (CHEBI:38124) |
| scalaradial (CHEBI:67731) is a enal (CHEBI:51688) |
| scalaradial (CHEBI:67731) is a scalarane sesterterpenoid (CHEBI:59370) |
| IUPAC Name |
|---|
| (4aS,4bR,6S,6aS,7R,10aS,10bR,12aS)-7,8-diformyl-1,1,4a,6a,10b-pentamethyl-1,2,3,4,4a,4b,5,6,6a,7,10,10a,10b,11,12,12a-hexadecahydrochrysen-6-yl acetate |
| Synonym | Source |
|---|---|
| (+)-scalaradial | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:53527-28-9 | ChemIDplus |
| Citations |
|---|