EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O3 |
| Net Charge | 0 |
| Average Mass | 412.614 |
| Monoisotopic Mass | 412.29775 |
| SMILES | [H][C@]12C[C@H](OC(C)=O)[C@]3(C)c4cocc4CC[C@@]3([H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H40O3/c1-17(28)30-23-14-22-25(4)12-7-11-24(2,3)20(25)10-13-26(22,5)21-9-8-18-15-29-16-19(18)27(21,23)6/h15-16,20-23H,7-14H2,1-6H3/t20-,21-,22+,23-,25-,26-,27+/m0/s1 |
| InChIKey | WAADVUIWRUHATI-NXQORITBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-Deacetoxy-12-epi-scalarafuranacetate (CHEBI:67730) has role metabolite (CHEBI:25212) |
| 16-Deacetoxy-12-epi-scalarafuranacetate (CHEBI:67730) is a scalarane sesterterpenoid (CHEBI:59370) |
| Citations |
|---|