EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O4 |
| Net Charge | 0 |
| Average Mass | 430.629 |
| Monoisotopic Mass | 430.30831 |
| SMILES | [H][C@]12C[C@H](OC(C)=O)[C@@]3(C)[C@@]([H])(CC=C4CO[C@@H](O)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H42O4/c1-16(28)31-21-14-20-25(4)12-7-11-24(2,3)18(25)10-13-26(20,5)19-9-8-17-15-30-23(29)22(17)27(19,21)6/h8,18-23,29H,7,9-15H2,1-6H3/t18-,19-,20+,21-,22+,23+,25-,26-,27+/m0/s1 |
| InChIKey | IDZDIJBVDDHIIM-XJYMFQQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12alpha-Deoxoscalarin (CHEBI:67729) has role metabolite (CHEBI:25212) |
| 12alpha-Deoxoscalarin (CHEBI:67729) is a scalarane sesterterpenoid (CHEBI:59370) |
| Citations |
|---|