EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCC1=CC(=O)OC1 |
| InChI | InChI=1S/C21H28O3/c1-17(8-4-10-19-12-13-23-15-19)6-3-7-18(2)9-5-11-20-14-21(22)24-16-20/h7-8,12-15H,3-6,9-11,16H2,1-2H3/b17-8+,18-7+ |
| InChIKey | WCHKEOQZUQGPSS-ZTRBTYSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Furospongolide (CHEBI:67727) has role metabolite (CHEBI:25212) |
| Furospongolide (CHEBI:67727) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| 3-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]-2H-furan-5-one | ChEBI |
| Citations |
|---|