EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O3 |
| Net Charge | 0 |
| Average Mass | 330.468 |
| Monoisotopic Mass | 330.21949 |
| SMILES | C/C(=C\CCc1ccoc1)C[C@H](O)C[C@@H](C)CCCc1ccoc1 |
| InChI | InChI=1S/C21H30O3/c1-17(5-3-7-19-9-11-23-15-19)13-21(22)14-18(2)6-4-8-20-10-12-24-16-20/h5,9-12,15-16,18,21-22H,3-4,6-8,13-14H2,1-2H3/b17-5+/t18-,21-/m0/s1 |
| InChIKey | SFDYMPBPKHWFDV-MQPQBDNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Furospongin-1 (CHEBI:67726) has role metabolite (CHEBI:25212) |
| Furospongin-1 (CHEBI:67726) is a aliphatic alcohol (CHEBI:2571) |
| Synonym | Source |
|---|---|
| (E,6R,8S)-1,11-bis(furan-3-yl)-4,8-dimethylundec-3-en-6-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:35075-74-2 | ChemIDplus |
| Citations |
|---|