EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | C/C(=C\CCc1ccoc1)CC(=O)C[C@@H](C)CCCc1ccoc1 |
| InChI | InChI=1S/C21H28O3/c1-17(5-3-7-19-9-11-23-15-19)13-21(22)14-18(2)6-4-8-20-10-12-24-16-20/h5,9-12,15-16,18H,3-4,6-8,13-14H2,1-2H3/b17-5+/t18-/m0/s1 |
| InChIKey | DARLMVMUSMRSIS-HQCRTTESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrofurospongin-2 (CHEBI:67725) has role metabolite (CHEBI:25212) |
| Dihydrofurospongin-2 (CHEBI:67725) is a furans (CHEBI:24129) |
| Synonym | Source |
|---|---|
| (3E,8S)-1,11-Di(3-furyl)-4,8-dimethyl-3-undecen-6-one | ChEBI |
| Citations |
|---|