EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCc1ccoc1 |
| InChI | InChI=1S/C21H28O2/c1-18(8-4-10-20-12-14-22-16-20)6-3-7-19(2)9-5-11-21-13-15-23-17-21/h6,9,12-17H,3-5,7-8,10-11H2,1-2H3/b18-6+,19-9+ |
| InChIKey | CXOKEXPLOGZXRM-STIQIAQSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anhydrofurospongin-1 (CHEBI:67723) has role metabolite (CHEBI:25212) |
| Anhydrofurospongin-1 (CHEBI:67723) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| 3,3'-[(3E,7E)-4,8-Dimethyl-3,7-undecadiene-1,11-diyl]difuran | ChEBI |
| Citations |
|---|