EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O5 |
| Net Charge | 0 |
| Average Mass | 428.569 |
| Monoisotopic Mass | 428.25627 |
| SMILES | COC(=O)/C(=C\CC/C(C)=C/CC/C(C)=C/CCc1ccoc1)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C26H36O5/c1-20(11-6-14-23-17-18-31-19-23)9-5-10-21(2)12-7-15-24(26(29)30-4)16-8-13-22(3)25(27)28/h10-11,13,15,17-19H,5-9,12,14,16H2,1-4H3,(H,27,28)/b20-11+,21-10+,22-13+,24-15- |
| InChIKey | OAOUOCLVLBNQNV-STZPRAENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isofurospongin-4 (CHEBI:67722) has role metabolite (CHEBI:25212) |
| Isofurospongin-4 (CHEBI:67722) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| (2E,6Z,10E,14E)-17-(furan-3-yl)-6-methoxycarbonyl-2,10,14-trimethylheptadeca-2,6,10,14-tetraenoic acid | ChEBI |
| Citations |
|---|