EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O4 |
| Net Charge | 0 |
| Average Mass | 366.542 |
| Monoisotopic Mass | 366.27701 |
| SMILES | CCCCCCC/C(C)=C\C(=O)OC(C)CCCC/C=C(/C)CC(=O)O |
| InChI | InChI=1S/C22H38O4/c1-5-6-7-8-10-14-19(3)17-22(25)26-20(4)15-12-9-11-13-18(2)16-21(23)24/h13,17,20H,5-12,14-16H2,1-4H3,(H,23,24)/b18-13-,19-17- |
| InChIKey | GUGWWNGSTOHWGD-MAFYCXDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Officinoic acid B (CHEBI:67721) has role metabolite (CHEBI:25212) |
| Officinoic acid B (CHEBI:67721) is a fatty acid ester (CHEBI:35748) |
| Synonym | Source |
|---|---|
| (Z)-3-methyl-9-[(Z)-3-methyldec-2-enoyl]oxydec-3-enoic acid | ChEBI |
| Citations |
|---|