EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4 |
| Net Charge | 0 |
| Average Mass | 346.467 |
| Monoisotopic Mass | 346.21441 |
| SMILES | C[C@@H](CCCc1ccoc1)C[C@@H](O)C[C@]1(C)O[C@@H]1CCc1ccoc1 |
| InChI | InChI=1S/C21H30O4/c1-16(4-3-5-17-8-10-23-14-17)12-19(22)13-21(2)20(25-21)7-6-18-9-11-24-15-18/h8-11,14-16,19-20,22H,3-7,12-13H2,1-2H3/t16-,19+,20+,21-/m0/s1 |
| InChIKey | AUEKROIOGGQZNX-ZXNZYJFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia officinalis (ncbitaxon:252964) | - | PubMed (21548580) | Diethyl ether soluble portion of acetone extract of chopped, frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-Epoxyfurospongin-1, (rel)- (CHEBI:67719) has role metabolite (CHEBI:25212) |
| 7,8-Epoxyfurospongin-1, (rel)- (CHEBI:67719) is a aliphatic alcohol (CHEBI:2571) |
| Synonym | Source |
|---|---|
| rel-(2R,4S)-7-(3-Furyl)-1-{(2R,3R)-3-[2-(3-furyl)ethyl]-2-methyl-2-oxiranyl}-4-methyl-2-heptanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27025526 | ChemSpider |
| Citations |
|---|