EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H33NO2 |
| Net Charge | 0 |
| Average Mass | 343.511 |
| Monoisotopic Mass | 343.25113 |
| SMILES | [H][C@@]12CC=C3C[C@@H](NC)CC[C@]3(C)[C@@]1([H])CC[C@]13C(=O)O[C@@H](C)[C@@]1([H])CC[C@@]23[H] |
| InChI | InChI=1S/C22H33NO2/c1-13-17-6-7-19-16-5-4-14-12-15(23-3)8-10-21(14,2)18(16)9-11-22(17,19)20(24)25-13/h4,13,15-19,23H,5-12H2,1-3H3/t13-,15-,16+,17+,18-,19-,21-,22-/m0/s1 |
| InChIKey | RSFPISDAJMWREU-CDFICMNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kibatalia laurifolia (IPNI:79456-1) | leaf (BTO:0000713) | PubMed (21443172) | Dried, ground leaves were alkalized with NH4OH & extracted successively with n-hexane, CH2Cl2 & MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Paravallarine (CHEBI:67712) has role metabolite (CHEBI:25212) |
| Paravallarine (CHEBI:67712) is a steroid (CHEBI:35341) |
| Synonyms | Source |
|---|---|
| Paravallarine | KEGG COMPOUND |
| (3beta,20S)-3-(Methylamino)-18,20-epoxypregn-5-en-18-one | ChEBI |
| Citations |
|---|