EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O5 |
| Net Charge | 0 |
| Average Mass | 296.363 |
| Monoisotopic Mass | 296.16237 |
| SMILES | CC(=O)O[C@H]1CC[C@]23C[C@@H]1OO[C@@]2(C)C(=O)CCC3(C)C |
| InChI | InChI=1S/C16H24O5/c1-10(17)19-11-5-8-16-9-12(11)20-21-15(16,4)13(18)6-7-14(16,2)3/h11-12H,5-9H2,1-4H3/t11-,12-,15-,16+/m0/s1 |
| InChIKey | KLVLZPYIONMIPB-GVAFMPQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces flavus (ncbitaxon:5095) | mycelium (BTO:0001436) | PubMed (21545109) | Endophytic fungus on fresh leaves of Sonneratia apetala,MeOH extract of mycelia & solid rice medium |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talaperoxide B (CHEBI:67707) has role metabolite (CHEBI:25212) |
| Talaperoxide B (CHEBI:67707) is a cyclohexanones (CHEBI:23482) |
| Synonym | Source |
|---|---|
| (1R,6R,9S,10S)-2,2,6-Trimethyl-5-oxo-7,8-dioxatricyclo[7.3.1.0(1,6)]tridec-10-yl acetate | ChEBI |
| Citations |
|---|