EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O6 |
| Net Charge | 0 |
| Average Mass | 480.601 |
| Monoisotopic Mass | 480.25119 |
| SMILES | [H][C@]12O[C@]1(C)CC[C@]1([H])C(C)(C)[C@]1([H])/C=C(\CO)C(=O)[C@@]1(OC(=O)/C=C/c3ccccc3)C[C@H](C)[C@H](O)[C@]21[H] |
| InChI | InChI=1S/C29H36O6/c1-17-15-29(34-22(31)11-10-18-8-6-5-7-9-18)23(24(17)32)26-28(4,35-26)13-12-20-21(27(20,2)3)14-19(16-30)25(29)33/h5-11,14,17,20-21,23-24,26,30,32H,12-13,15-16H2,1-4H3/b11-10+,19-14+/t17-,20-,21+,23+,24-,26+,28+,29+/m0/s1 |
| InChIKey | ZLHWPIKKGZWBKR-JARHKAFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia micractina (IPNI:347344-1) | root (BTO:0001188) | PubMed (21534583) | Ethanolic extract of roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jolkinol A (CHEBI:67705) is a cinnamate ester (CHEBI:36087) |
| jolkinol A (CHEBI:67705) is a epoxide (CHEBI:32955) |
| jolkinol A (CHEBI:67705) is a lathyrane diterpenoid (CHEBI:85247) |
| IUPAC Name |
|---|
| (1aR,1bR,2S,3S,4aR,6E,7aR,8aS,10aR)-2-hydroxy-6-(hydroxymethyl)-3,8,8,10a-tetramethyl-5-oxo-1a,1b,2,3,4,5,7a,8,8a,9,10,10a-dodecahydro-4aH-cyclopenta[10,11]cyclopropa[5,6]cycloundeca[1,2-b]oxiren-4a-yl (2E)-3-phenylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9885629 | Reaxys |
| CAS:62820-11-5 | ChemIDplus |
| Citations |
|---|