EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O5 |
| Net Charge | 0 |
| Average Mass | 438.564 |
| Monoisotopic Mass | 438.24062 |
| SMILES | [H][C@@]12[C@H](O)/C(C)=C\C[C@]3([H])C(C)(C)[C@]3([H])/C=C(\C)C(=O)[C@@]1(OC(=O)c1ccccc1)C[C@H](C)[C@@H]2O |
| InChI | InChI=1S/C27H34O5/c1-15-11-12-19-20(26(19,4)5)13-16(2)24(30)27(14-17(3)23(29)21(27)22(15)28)32-25(31)18-9-7-6-8-10-18/h6-11,13,17,19-23,28-29H,12,14H2,1-5H3/b15-11-,16-13+/t17-,19-,20+,21-,22+,23-,27+/m0/s1 |
| InChIKey | LIXVTMWBYCIOIH-MMJPDQHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia micractina (IPNI:347344-1) | root (BTO:0001188) | PubMed (21534583) | Ethanolic extract of roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15β-O-benzoyl-5alpha-hydroxyisolathyrol (CHEBI:67704) has role vasodilator agent (CHEBI:35620) |
| 15β-O-benzoyl-5alpha-hydroxyisolathyrol (CHEBI:67704) is a benzoate ester (CHEBI:36054) |
| 15β-O-benzoyl-5alpha-hydroxyisolathyrol (CHEBI:67704) is a lathyrane diterpenoid (CHEBI:85247) |
| IUPAC Name |
|---|
| (1aR,2E,4aR,6S,7S,7aR,8S,9Z,11aS)-7,8-dihydroxy-1,1,3,6,9-pentamethyl-4-oxo-1,1a,4,5,6,7,7a,8,11,11a-decahydro-4aH-cyclopenta[a]cyclopropa[f][11]annulen-4a-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7152409 | Reaxys |
| Citations |
|---|