EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O5 |
| Net Charge | 0 |
| Average Mass | 402.531 |
| Monoisotopic Mass | 402.24062 |
| SMILES | [H][C@@]12/C=C(\C)CC[C@]3([H])C(C)(C)[C@]3([H])/C=C(\C)C(=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C24H34O5/c1-13-8-9-18-19(23(18,6)7)11-14(2)22(27)24(29-17(5)26)12-15(3)21(20(24)10-13)28-16(4)25/h10-11,15,18-21H,8-9,12H2,1-7H3/b13-10+,14-11+/t15-,18-,19+,20-,21-,24+/m0/s1 |
| InChIKey | NGGOVTJUPVNNNR-CLHRSZSESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia micractina (IPNI:347344-1) | root (BTO:0001188) | PubMed (21534583) | Ethanolic extract of roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(5E,12E,2S,3S,4S,9S,11S,15R)-3,15-diacetoxylathyra-5,12-dien-14-one (CHEBI:67694) is a acetate ester (CHEBI:47622) |
| (−)-(5E,12E,2S,3S,4S,9S,11S,15R)-3,15-diacetoxylathyra-5,12-dien-14-one (CHEBI:67694) is a lathyrane diterpenoid (CHEBI:85247) |
| IUPAC Name |
|---|
| (1aR,2E,4aR,6S,7S,7aS,8E,11aS)-1,1,3,6,9-pentamethyl-4-oxo-1,1a,4,5,6,7,7a,10,11,11a-decahydro-4aH-cyclopenta[a]cyclopropa[f][11]annulene-4a,7-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21556522 | Reaxys |
| Citations |
|---|