EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O6 |
| Net Charge | 0 |
| Average Mass | 418.530 |
| Monoisotopic Mass | 418.23554 |
| SMILES | [H][C@]12O[C@]1(C)CC[C@]1([H])C(C)(C)[C@]1([H])/C=C(\C)C(=O)[C@@]1(OC(C)=O)C[C@H](C)[C@H](OC(C)=O)[C@]21[H] |
| InChI | InChI=1S/C24H34O6/c1-12-10-17-16(22(17,5)6)8-9-23(7)21(30-23)18-19(28-14(3)25)13(2)11-24(18,20(12)27)29-15(4)26/h10,13,16-19,21H,8-9,11H2,1-7H3/b12-10+/t13-,16-,17+,18+,19-,21+,23+,24+/m0/s1 |
| InChIKey | JWKHZEAVVLNPDQ-VAMLIGRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia micractina (IPNI:347344-1) | root (BTO:0001188) | PubMed (21534583) | Ethanolic extract of roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(12E,2S,3S,4R,5R,6R,9S,11S,15R)-3,15-diacetoxy-5,6-epoxylathyr-12-en-14-one (CHEBI:67687) is a acetate ester (CHEBI:47622) |
| (−)-(12E,2S,3S,4R,5R,6R,9S,11S,15R)-3,15-diacetoxy-5,6-epoxylathyr-12-en-14-one (CHEBI:67687) is a epoxide (CHEBI:32955) |
| (−)-(12E,2S,3S,4R,5R,6R,9S,11S,15R)-3,15-diacetoxy-5,6-epoxylathyr-12-en-14-one (CHEBI:67687) is a lathyrane diterpenoid (CHEBI:85247) |
| IUPAC Name |
|---|
| (1aR,1bR,2S,3S,4aR,6E,7aR,8aS,10aR)-3,6,8,8,10a-pentamethyl-5-oxo-1a,1b,2,3,4,5,7a,8,8a,9,10,10a-dodecahydro-4aH-cyclopenta[10,11]cyclopropa[5,6]cycloundeca[1,2-b]oxirene-2,4a-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21556521 | Reaxys |
| Citations |
|---|