EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O8 |
| Net Charge | 0 |
| Average Mass | 448.512 |
| Monoisotopic Mass | 448.20972 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3([H])[C@]45CCC[C@@](C)(COC(C)=O)[C@@]4([H])[C@H](O)[C@@](O)(OC5)[C@]3(C1)C(=O)C2=C |
| InChI | InChI=1S/C24H32O8/c1-12-15-8-16(32-14(3)26)17-22-7-5-6-21(4,10-30-13(2)25)18(22)20(28)24(29,31-11-22)23(17,9-15)19(12)27/h15-18,20,28-29H,1,5-11H2,2-4H3/t15-,16+,17-,18+,20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | NWQZANHFNNXIAG-BGOLOJIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Longikaurin F (CHEBI:67684) has role metabolite (CHEBI:25212) |
| Longikaurin F (CHEBI:67684) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|