EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O7 |
| Net Charge | 0 |
| Average Mass | 408.491 |
| Monoisotopic Mass | 408.21480 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)[C@@H](O)[C@@]1([C@@H]3O)[C@]1(O)OC[C@]23[C@@H](OC(C)=O)CCC(C)(C)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C22H32O7/c1-10-12-5-6-13-20-9-28-22(27,21(13,16(10)24)17(12)25)18(26)15(20)19(3,4)8-7-14(20)29-11(2)23/h12-18,24-27H,1,5-9H2,2-4H3/t12-,13+,14+,15-,16-,17-,18+,20-,21+,22-/m1/s1 |
| InChIKey | BSANMXUGYAXKKD-XCVBNCFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lasiokaurinol (CHEBI:67682) has role metabolite (CHEBI:25212) |
| Lasiokaurinol (CHEBI:67682) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|