EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O7 |
| Net Charge | 0 |
| Average Mass | 394.464 |
| Monoisotopic Mass | 394.19915 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)C(=O)[C@@]1([C@@H]3O)[C@]1(O)O[C@@H](OC)[C@]23[C@@H](O)CCC(C)(C)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C21H30O7/c1-9-10-5-6-11-19-12(22)7-8-18(2,3)13(19)16(25)21(26,28-17(19)27-4)20(11,14(9)23)15(10)24/h10-13,15-17,22,24-26H,1,5-8H2,2-4H3/t10-,11+,12+,13-,15-,16+,17-,19+,20+,21-/m1/s1 |
| InChIKey | UHERRNNNKBWWKU-JVWDHMGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rabdoternin E (CHEBI:67680) has role metabolite (CHEBI:25212) |
| Rabdoternin E (CHEBI:67680) is a kaurane diterpenoid (CHEBI:53666) |
| Manual Xrefs | Databases |
|---|---|
| 23311656 | ChemSpider |
| Citations |
|---|