EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O6 |
| Net Charge | 0 |
| Average Mass | 404.503 |
| Monoisotopic Mass | 404.21989 |
| SMILES | [H][C@]12C[C@@]3(C(=O)C1=C)[C@]1([H])[C@@]45CO[C@]3(O)[C@@H](O)[C@]4([H])C(C)(C)CC[C@]5([H])OC(C)(C)O[C@@]1([H])C2 |
| InChI | InChI=1S/C23H32O6/c1-11-12-8-13-15-21-10-27-23(26,22(15,9-12)17(11)24)18(25)16(21)19(2,3)7-6-14(21)29-20(4,5)28-13/h12-16,18,25-26H,1,6-10H2,2-5H3/t12-,13-,14-,15-,16+,18-,21-,22-,23+/m0/s1 |
| InChIKey | FTUVGFINORCONN-AWHSDHHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lasiodonin acetonide (CHEBI:67678) has role metabolite (CHEBI:25212) |
| Lasiodonin acetonide (CHEBI:67678) is a oxacycle (CHEBI:38104) |
| Citations |
|---|