EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)C(=O)[C@@]1([C@@H]3O)[C@]1(O)OC[C@]23CCCC(C)(C)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C20H28O5/c1-10-11-5-6-12-18-8-4-7-17(2,3)13(18)16(23)20(24,25-9-18)19(12,14(10)21)15(11)22/h11-13,15-16,22-24H,1,4-9H2,2-3H3/t11-,12+,13-,15-,16+,18-,19+,20-/m1/s1 |
| InChIKey | PSVHVXLCVSKJGM-NIPWPZGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Longikaurin A (CHEBI:67677) has role metabolite (CHEBI:25212) |
| Longikaurin A (CHEBI:67677) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| ent-Kaur-16-en-15-one, 7,20-epoxy-6,7,14-trihydroxy-,(6beta,7alpha,14R)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:75207-67-9 | ChemIDplus |
| Citations |
|---|