EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)C(=O)[C@]14[C@H]3OC1O[C@]4(O)[C@@H](O)[C@]3([H])C(C)(C)CCC[C@@]123 |
| InChI | InChI=1S/C20H26O5/c1-9-10-5-6-11-18-8-4-7-17(2,3)12(18)14(22)20(23)19(11,13(9)21)15(10)24-16(18)25-20/h10-12,14-16,22-23H,1,4-8H2,2-3H3/t10-,11+,12-,14+,15+,16?,18-,19+,20-/m1/s1 |
| InChIKey | ZKUQCTVJZQFAKY-BHYGTAQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xerophilusin B (CHEBI:67672) has role metabolite (CHEBI:25212) |
| Xerophilusin B (CHEBI:67672) is a dioxanes (CHEBI:46926) |
| Citations |
|---|